Online Database of Chemicals from Around the World
|
CAS#: 950693-94-4 Product: 3-Chloro-2-(phenylsulfonyl)pyridine No suppilers available for the product. |
| Name | 3-Chloro-2-(phenylsulfonyl)pyridine |
|---|---|
| Synonyms | 3-Chlor-2-(phenylsulfonyl)pyridin; 3-Chloro-2-(phenylsulfonyl)pyridine; 3-Chloro-2-(phénylsulfonyl)pyridine |
| Molecular Structure |  |
| Molecular Formula | C11H8ClNO2S |
| Molecular Weight | 253.70 |
| CAS Registry Number | 950693-94-4 |
| SMILES | c1ccc(cc1)S(=O)(=O)c2c(cccn2)Cl |
| InChI | 1S/C11H8ClNO2S/c12-10-7-4-8-13-11(10)16(14,15)9-5-2-1-3-6-9/h1-8H |
| InChIKey | FKXNPYXLKZPBMG-UHFFFAOYSA-N |
| Density | 1.4±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 426.6±30.0°C at 760 mmHg (Cal.) |
| Flash point | 211.8±24.6°C (Cal.) |
| Refractive index | 1.604 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Chloro-2-(phenylsulfonyl)pyridine |