Online Database of Chemicals from Around the World
| Otava Ltd. | Ukraine | Inquire | ||
|---|---|---|---|---|
 |
+380 (44) 522-2458 | |||
 |
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Name | 3,3-Dimethylindan-5-Ol |
|---|---|
| Synonyms | 3,3-Dimethylindan-5-Ol; 3,3-Dimethyl-5-Indanol |
| Molecular Structure |  |
| Molecular Formula | C11H14O |
| Molecular Weight | 162.23 |
| CAS Registry Number | 4957-24-8 |
| EINECS | 225-600-1 |
| SMILES | C1=C(C=CC2=C1C(CC2)(C)C)O |
| InChI | 1S/C11H14O/c1-11(2)6-5-8-3-4-9(12)7-10(8)11/h3-4,7,12H,5-6H2,1-2H3 |
| InChIKey | PAIGLICXCCZBCJ-UHFFFAOYSA-N |
| Density | 1.044g/cm3 (Cal.) |
|---|---|
| Boiling point | 260.711°C at 760 mmHg (Cal.) |
| Flash point | 118.631°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,3-Dimethylindan-5-Ol |