Online Database of Chemicals from Around the World
| Otava Ltd. | Ukraine | Inquire | ||
|---|---|---|---|---|
 |
+380 (44) 522-2458 | |||
 |
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Name | 1,1-Dimethylindan-4-Ol |
|---|---|
| Synonyms | 1,1-Dimethylindan-4-Ol; 1,1-Dimethyl-4-Indanol |
| Molecular Structure |  |
| Molecular Formula | C11H14O |
| Molecular Weight | 162.23 |
| CAS Registry Number | 91969-55-0 |
| EINECS | 295-247-6 |
| SMILES | C2=C(C1=C(C(CC1)(C)C)C=C2)O |
| InChI | 1S/C11H14O/c1-11(2)7-6-8-9(11)4-3-5-10(8)12/h3-5,12H,6-7H2,1-2H3 |
| InChIKey | FCCRASGUAOTJHA-UHFFFAOYSA-N |
| Density | 1.044g/cm3 (Cal.) |
|---|---|
| Boiling point | 246.175°C at 760 mmHg (Cal.) |
| Flash point | 110.794°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1-Dimethylindan-4-Ol |