Online Database of Chemicals from Around the World
| Otava Ltd. | Ukraine | Inquire | ||
|---|---|---|---|---|
 |
+380 (44) 522-2458 | |||
 |
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Name | 1,4-Naphthoquinone 1-Oxime |
|---|---|
| Synonyms | 4-Nitroso-1-Naphthalenol; 4-Nitroso-1-Naphthol; 1,4-Naphthalenedione, Monooxime |
| Molecular Structure |  |
| Molecular Formula | C10H7NO2 |
| Molecular Weight | 173.17 |
| CAS Registry Number | 4965-30-4 (605-60-7) |
| SMILES | C1=C2C(=CC=C1)C(=CC=C2N=O)O |
| InChI | 1S/C10H7NO2/c12-10-6-5-9(11-13)7-3-1-2-4-8(7)10/h1-6,12H |
| InChIKey | ZVNOVIBCAIDQOE-UHFFFAOYSA-N |
| Density | 1.276g/cm3 (Cal.) |
|---|---|
| Boiling point | 382.699°C at 760 mmHg (Cal.) |
| Flash point | 185.25°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,4-Naphthoquinone 1-Oxime |