Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 1,3,2,4-Dioxadithiane 2,2,4,4-Tetraoxide |
|---|---|
| Synonyms | 1,3,2,4-Dioxadithiane, 2,2,4,4-Tetraoxide; 1,3,2,4-Dioxadithiane, 2,2,4,4-Tetroxide |
| Molecular Structure |  |
| Molecular Formula | C2H4O6S2 |
| Molecular Weight | 188.17 |
| CAS Registry Number | 503-41-3 |
| EINECS | 207-968-5 |
| SMILES | O=[S]1(O[S](OCC1)(=O)=O)=O |
| InChI | 1S/C2H4O6S2/c3-9(4)2-1-7-10(5,6)8-9/h1-2H2 |
| InChIKey | VSANMHWDSONVEE-UHFFFAOYSA-N |
| Density | 1.851g/cm3 (Cal.) |
|---|---|
| Boiling point | 327.532°C at 760 mmHg (Cal.) |
| Flash point | 151.886°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3,2,4-Dioxadithiane 2,2,4,4-Tetraoxide |