Online Database of Chemicals from Around the World
|
CAS#: 99591-72-7 Product: 1,5,2,4-Dioxadithiocane 2,2,4,4-Tetraoxide No suppilers available for the product. |
| Name | 1,5,2,4-Dioxadithiocane 2,2,4,4-Tetraoxide |
|---|---|
| Synonyms | 1,5,2,4-Dioxadithiocane, 2,2,4,4-Tetraoxide; Nsc348963; Nci60_003100 |
| Molecular Structure |  |
| Molecular Formula | C4H8O6S2 |
| Molecular Weight | 216.22 |
| CAS Registry Number | 99591-72-7 |
| SMILES | O=[S]1(OCCCO[S](C1)(=O)=O)=O |
| InChI | 1S/C4H8O6S2/c5-11(6)4-12(7,8)10-3-1-2-9-11/h1-4H2 |
| InChIKey | APPZESCOGKWYIH-UHFFFAOYSA-N |
| Density | 1.576g/cm3 (Cal.) |
|---|---|
| Boiling point | 558.607°C at 760 mmHg (Cal.) |
| Flash point | 291.635°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,5,2,4-Dioxadithiocane 2,2,4,4-Tetraoxide |