Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | Methyl 2-(2-Fluoroacryloyl)Benzoate |
|---|---|
| Synonyms | methyl 2-(2-fluoroacryloyl)benzoate |
| Molecular Structure |  |
| Molecular Formula | C11H9FO3 |
| Molecular Weight | 208.19 |
| CAS Registry Number | 506437-41-8 |
| SMILES | COC(=O)c1ccccc1C(=O)C(=C)F |
| InChI | 1S/C11H9FO3/c1-7(12)10(13)8-5-3-4-6-9(8)11(14)15-2/h3-6H,1H2,2H3 |
| InChIKey | YADPBLATRYKDHZ-UHFFFAOYSA-N |
| Density | 1.185g/cm3 (Cal.) |
|---|---|
| Boiling point | 311.999°C at 760 mmHg (Cal.) |
| Flash point | 137.912°C (Cal.) |
| Refractive index | 1.508 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 2-(2-Fluoroacryloyl)Benzoate |