Online Database of Chemicals from Around the World
| Otava Ltd. | Ukraine | Inquire | ||
|---|---|---|---|---|
 |
+380 (44) 522-2458 | |||
 |
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Name | 4-Methylfluoren-9-One |
|---|---|
| Synonyms | 4-Methyl-9-Fluorenone; Methylfluorenone |
| Molecular Structure |  |
| Molecular Formula | C14H10O |
| Molecular Weight | 194.23 |
| CAS Registry Number | 79147-47-0 |
| SMILES | C3=CC=C2C(=O)C1=CC=CC=C1C2=C3C |
| InChI | 1S/C14H10O/c1-9-5-4-8-12-13(9)10-6-2-3-7-11(10)14(12)15/h2-8H,1H3 |
| InChIKey | QCVMLXNTSUFLGI-UHFFFAOYSA-N |
| Density | 1.206g/cm3 (Cal.) |
|---|---|
| Boiling point | 359.521°C at 760 mmHg (Cal.) |
| Flash point | 158.854°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Methylfluoren-9-One |