Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Otava Ltd. | Ukraine | Inquire | ||
|---|---|---|---|---|
|
+380 (44) 522-2458 | |||
|
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Name | 2-[(2-Fluoro-4-Nitrophenyl)Amino]Ethanol |
|---|---|
| Synonyms | 2-((2-fluoro-4-nitrophenyl)amino)ethanol; ETHANOL, 2-[(2-FLUORO-4-NITROPHENYL)AMINO]- (9CI) |
| Molecular Structure | ![CAS#: 509151-97-7， 2-[(2-Fluoro-4-Nitrophenyl)Amino]Ethanol](/moreStructures/509151-97-7.gif) |
| Molecular Formula | C8H9FN2O3 |
| Molecular Weight | 200.17 |
| CAS Registry Number | 509151-97-7 |
| SMILES | c1cc(c(cc1[N+](=O)[O-])F)NCCO |
| InChI | 1S/C8H9FN2O3/c9-7-5-6(11(13)14)1-2-8(7)10-3-4-12/h1-2,5,10,12H,3-4H2 |
| InChIKey | QFQBBENWEBUOGW-UHFFFAOYSA-N |
| Density | 1.441g/cm3 (Cal.) |
|---|---|
| Boiling point | 381.153°C at 760 mmHg (Cal.) |
| Flash point | 184.315°C (Cal.) |
| Refractive index | 1.616 (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2-[(2-Fluoro-4-Nitrophenyl)Amino]Ethanol |