Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 2-[(2-Fluoro-6-nitrophenyl)amino]ethanol |
|---|---|
| Synonyms | 2-((2-fluoro-6-nitrophenyl)amino)ethanol |
| Molecular Structure | ![CAS#: 796973-02-9， 2-[(2-Fluoro-6-nitrophenyl)amino]ethanol](/moreStructures/796973-02-9.gif) |
| Molecular Formula | C8H9FN2O3 |
| Molecular Weight | 200.17 |
| CAS Registry Number | 796973-02-9 |
| SMILES | [O-][N+](=O)c1cccc(F)c1NCCO |
| InChI | 1S/C8H9FN2O3/c9-6-2-1-3-7(11(13)14)8(6)10-4-5-12/h1-3,10,12H,4-5H2 |
| InChIKey | HABIAWQPYSFYAP-UHFFFAOYSA-N |
| Density | 1.441g/cm3 (Cal.) |
|---|---|
| Boiling point | 368.591°C at 760 mmHg (Cal.) |
| Flash point | 176.718°C (Cal.) |
| Refractive index | 1.616 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-[(2-Fluoro-6-nitrophenyl)amino]ethanol |