Online Database of Chemicals from Around the World
|
CAS#: 50976-02-8 Product: 3a,4,7,7alpha-Tetrahydro-4,7-Methano-1H-Indenyl Acrylate No suppilers available for the product. |
| Name | 3a,4,7,7alpha-Tetrahydro-4,7-Methano-1H-Indenyl Acrylate |
|---|---|
| Synonyms | 3A,4,7,7A-Tetrahydro-4,7-Methano-1H-Indenyl Acrylate; Acrylic Acid, ((3A,4,7,7A-Tetrahydro)4,7-Methanoindenyl) Ester; Acrylic Acid, Dicyclopentadienyl Ester |
| Molecular Structure |  |
| Molecular Formula | C13H14O2 |
| Molecular Weight | 202.25 |
| CAS Registry Number | 50976-02-8 |
| EINECS | 256-874-0 |
| SMILES | O=C(OC3C2C1C=CC(C1)C2C=C3)C=C |
| InChI | 1S/C13H14O2/c1-2-12(14)15-11-6-5-10-8-3-4-9(7-8)13(10)11/h2-6,8-11,13H,1,7H2 |
| InChIKey | VEVJYJYFAXTUGJ-UHFFFAOYSA-N |
| Density | 1.154g/cm3 (Cal.) |
|---|---|
| Boiling point | 283.46°C at 760 mmHg (Cal.) |
| Flash point | 114.082°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3a,4,7,7alpha-Tetrahydro-4,7-Methano-1H-Indenyl Acrylate |