Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 1,4,4a,8a-Tetrahydro-1,4-methanonaphthalene-5,8-dione |
|---|---|
| Synonyms | Cyclopentadienebenzoquinone; Nsc25329; Wln: L C655 A Dv Gv Eu Jutj |
| Molecular Structure |  |
| Molecular Formula | C11H10O2 |
| Molecular Weight | 174.20 |
| CAS Registry Number | 51175-59-8 |
| SMILES | O=C3C1C(C2C=CC1C2)C(C=C3)=O |
| InChI | 1S/C11H10O2/c12-8-3-4-9(13)11-7-2-1-6(5-7)10(8)11/h1-4,6-7,10-11H,5H2 |
| InChIKey | FQLRTGXTYFCECH-UHFFFAOYSA-N |
| Density | 1.274g/cm3 (Cal.) |
|---|---|
| Boiling point | 317.556°C at 760 mmHg (Cal.) |
| Flash point | 118.895°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1,4,4a,8a-Tetrahydro-1,4-methanonaphthalene-5,8-dione |