Online Database of Chemicals from Around the World
|
CAS#: 51053-33-9 Product: Dinitropropylphenol No suppilers available for the product. |
| Name | Dinitropropylphenol |
|---|---|
| Synonyms | Dinitropropylphenol; Phenol, Dinitropropyl- |
| Molecular Structure |  |
| Molecular Formula | C9H10N2O5 |
| Molecular Weight | 226.19 |
| CAS Registry Number | 51053-33-9 |
| SMILES | C1=C(CCC([N+]([O-])=O)[N+]([O-])=O)C(=CC=C1)O |
| InChI | 1S/C9H10N2O5/c12-8-4-2-1-3-7(8)5-6-9(10(13)14)11(15)16/h1-4,9,12H,5-6H2 |
| InChIKey | YLIPAWHGPCUKFA-UHFFFAOYSA-N |
| Density | 1.387g/cm3 (Cal.) |
|---|---|
| Boiling point | 387.993°C at 760 mmHg (Cal.) |
| Flash point | 169.19°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dinitropropylphenol |