Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 2,2-Dinitropropanoic Acid |
|---|---|
| Synonyms | 2,2-dinitropropanoic acid |
| Molecular Structure |  |
| Molecular Formula | C3H4N2O6 |
| Molecular Weight | 164.07 |
| CAS Registry Number | 221048-05-1 |
| SMILES | O=C(O)C(C)(N(=O)=O)N(=O)=O |
| InChI | 1S/C3H4N2O6/c1-3(2(6)7,4(8)9)5(10)11/h1H3,(H,6,7) |
| InChIKey | IKXGLGLZHXEECO-UHFFFAOYSA-N |
| Density | 1.669g/cm3 (Cal.) |
|---|---|
| Boiling point | 273.21°C at 760 mmHg (Cal.) |
| Flash point | 127.689°C (Cal.) |
| Refractive index | 1.512 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2-Dinitropropanoic Acid |