Online Database of Chemicals from Around the World
|
CAS#: 5113-30-4 Product: 4-Methoxytriamterene No suppilers available for the product. |
| Name | 4-Methoxytriamterene |
|---|---|
| Synonyms | [2,4-Diamino-6-(4-Methoxyphenyl)Pteridin-7-Yl]Amine; 2,4,7-Pteridinetriamine, 6-(4-Methoxyphenyl)-; 4-Methoxytriamterene |
| Molecular Structure |  |
| Molecular Formula | C13H13N7O |
| Molecular Weight | 283.29 |
| CAS Registry Number | 5113-30-4 |
| SMILES | C1=CC(=CC=C1OC)C3=C(N=C2N=C(N=C(C2=N3)N)N)N |
| InChI | 1S/C13H13N7O/c1-21-7-4-2-6(3-5-7)8-10(14)18-12-9(17-8)11(15)19-13(16)20-12/h2-5H,1H3,(H6,14,15,16,18,19,20) |
| InChIKey | XXFIGLAYTZCDPY-UHFFFAOYSA-N |
| Density | 1.471g/cm3 (Cal.) |
|---|---|
| Boiling point | 594.176°C at 760 mmHg (Cal.) |
| Flash point | 313.147°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Methoxytriamterene |