Online Database of Chemicals from Around the World
|
CAS#: 879-67-4 Product: 2-Methoxy-p-Tolyl Acetate No suppilers available for the product. |
| Name | 2-Methoxy-p-Tolyl Acetate |
|---|---|
| Synonyms | (2-Methoxy-4-Methyl-Phenyl) Acetate; Acetic Acid (2-Methoxy-4-Methylphenyl) Ester; Acetic Acid (2-Methoxy-4-Methyl-Phenyl) Ester |
| Molecular Structure |  |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.20 |
| CAS Registry Number | 879-67-4 |
| EINECS | 212-908-6 |
| SMILES | C1=C(C=CC(=C1OC)OC(=O)C)C |
| InChI | 1S/C10H12O3/c1-7-4-5-9(13-8(2)11)10(6-7)12-3/h4-6H,1-3H3 |
| InChIKey | OMYVQMNBUXUYLM-UHFFFAOYSA-N |
| Density | 1.077g/cm3 (Cal.) |
|---|---|
| Boiling point | 231.103°C at 760 mmHg (Cal.) |
| Flash point | 89.341°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methoxy-p-Tolyl Acetate |