Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | (8alpha)-6-Methyl-Ergoline-8-Carboxylicacid Methyl Ester |
|---|---|
| Synonyms | Methyl 6-Methylergoline-8Alpha-Carboxylate |
| Molecular Structure |  |
| Molecular Formula | C17H20N2O2 |
| Molecular Weight | 284.36 |
| CAS Registry Number | 5143-94-2 |
| EINECS | 225-911-2 |
| SMILES | [C@H]34C(C2=C1C(=C[NH]C1=CC=C2)C3)C[C@@H](CN4C)C(=O)OC |
| InChI | 1S/C17H20N2O2/c1-19-9-11(17(20)21-2)6-13-12-4-3-5-14-16(12)10(8-18-14)7-15(13)19/h3-5,8,11,13,15,18H,6-7,9H2,1-2H3/t11-,13?,15+/m0/s1 |
| InChIKey | OSKZYLPFYNARRX-LKVSRFHLSA-N |
| Density | 1.228g/cm3 (Cal.) |
|---|---|
| Boiling point | 453.797°C at 760 mmHg (Cal.) |
| Flash point | 228.249°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (8alpha)-6-Methyl-Ergoline-8-Carboxylicacid Methyl Ester |