Online Database of Chemicals from Around the World
|
CAS#: 516-39-2 Product: (3beta,5alpha,11beta)-Pregnane-3,11,17,20,21-Pentol No suppilers available for the product. |
| Name | (3beta,5alpha,11beta)-Pregnane-3,11,17,20,21-Pentol |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C21H36O5 |
| Molecular Weight | 368.51 |
| CAS Registry Number | 516-39-2 |
| SMILES | OCC(O)[C@@]3(O)CC[C@H]2[C@@H]4CC[C@H]1C[C@@H](O)CC[C@]1(C)[C@H]4[C@@H](O)C[C@@]23C |
| InChI | 1S/C21H36O5/c1-19-7-5-13(23)9-12(19)3-4-14-15-6-8-21(26,17(25)11-22)20(15,2)10-16(24)18(14)19/h12-18,22-26H,3-11H2,1-2H3/t12-,13-,14-,15-,16-,17?,18+,19-,20-,21-/m0/s1 |
| InChIKey | FFPUNPBUZDTHJI-MEAWVKDGSA-N |
| Density | 1.253g/cm3 (Cal.) |
|---|---|
| Boiling point | 564.528°C at 760 mmHg (Cal.) |
| Flash point | 254.999°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (3beta,5alpha,11beta)-Pregnane-3,11,17,20,21-Pentol |