Online Database of Chemicals from Around the World
|
CAS#: 566-41-6 Product: (3beta,5alpha)-Pregnane-3,17,20,21-Tetrol No suppilers available for the product. |
| Name | (3beta,5alpha)-Pregnane-3,17,20,21-Tetrol |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C21H36O4 |
| Molecular Weight | 352.51 |
| CAS Registry Number | 566-41-6 |
| SMILES | OCC(O)[C@@]3(O)CC[C@H]2[C@@H]4CC[C@H]1C[C@@H](O)CC[C@]1(C)[C@H]4CC[C@@]23C |
| InChI | 1S/C21H36O4/c1-19-8-5-14(23)11-13(19)3-4-15-16(19)6-9-20(2)17(15)7-10-21(20,25)18(24)12-22/h13-18,22-25H,3-12H2,1-2H3/t13-,14-,15+,16-,17-,18?,19-,20-,21-/m0/s1 |
| InChIKey | MQSSTQLJJOVNQF-YJIIALKKSA-N |
| Density | 1.186g/cm3 (Cal.) |
|---|---|
| Boiling point | 524.317°C at 760 mmHg (Cal.) |
| Flash point | 235.68°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (3beta,5alpha)-Pregnane-3,17,20,21-Tetrol |