Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| SelectLab Chemicals GmbH | Germany | Inquire | ||
|---|---|---|---|---|
|
+49 (2383) 919-350 / 919-351 | |||
|
info@selectlab.de, | |||
| Chemical manufacturer | ||||
| Name | Trinitromethane |
|---|---|
| Synonyms | 4-01-00-00107 (Beilstein Handbook Reference); Brn 1708361 |
| Molecular Structure |  |
| Molecular Formula | CHN3O6 |
| Molecular Weight | 151.04 |
| CAS Registry Number | 517-25-9 |
| EINECS | 208-236-8 |
| SMILES | O=[N+]([O-])C([N+]([O-])=O)[N+]([O-])=O |
| InChI | 1S/CHN3O6/c5-2(6)1(3(7)8)4(9)10/h1H |
| InChIKey | LZGVDNRJCGPNDS-UHFFFAOYSA-N |
| Density | 1.8±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 175.1±20.0°C at 760 mmHg (Cal.) |
| Flash point | 73.0±14.6°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Trinitromethane |