|
CAS#: 517-46-4 Product: Strictinin No suppilers available for the product. |
| Name | Strictinin |
|---|---|
| Synonyms | Strictinin; Beta-D-Glucopyranose, Cyclic 4,6-(4,4',5,5',6,6'-Hexahydroxy(1,1'-Biphenyl)-2,2'-Dicarboxylate) 1-(3,4,5-Trihydroxybenzoate), Stereooisomer; .Beta.-D-Glucopyranose, Cyclic 4,6-(4,4',5,5',6,6'-Hexahydroxy(1,1'-Biphenyl)-2,2'-Dicarboxylate)-1-(3,4,5-Trihydroxybenzoate), Stereoisomer |
| Molecular Structure | ![]() |
| Molecular Formula | C27H22O18 |
| Molecular Weight | 634.46 |
| CAS Registry Number | 517-46-4 |
| SMILES | [C@@H]24OC(=O)C5=C(C1=C(O)C(=C(O)C=C1C(OC[C@H]2O[C@@H](OC(=O)C3=CC(=C(O)C(=C3)O)O)[C@H](O)[C@H]4O)=O)O)C(=C(O)C(=C5)O)O |
| InChI | 1S/C27H22O18/c28-9-1-6(2-10(29)16(9)32)24(39)45-27-22(38)21(37)23-13(43-27)5-42-25(40)7-3-11(30)17(33)19(35)14(7)15-8(26(41)44-23)4-12(31)18(34)20(15)36/h1-4,13,21-23,27-38H,5H2/t13-,21-,22-,23-,27+/m1/s1 |
| InChIKey | FYIJLTSMNXUNLT-CXQFPWCTSA-N |
| Density | 2.11g/cm3 (Cal.) |
|---|---|
| Boiling point | 1280.848°C at 760 mmHg (Cal.) |
| Flash point | 418.789°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Strictinin |