Online Database of Chemicals from Around the World
|
CAS#: 51794-04-8 Product: Dithranol 1,8-Diacetate No suppilers available for the product. |
| Name | Dithranol 1,8-Diacetate |
|---|---|
| Synonyms | (8-Acetoxy-9-Hydroxy-1-Anthryl) Acetate; Acetic Acid (8-Acetoxy-9-Hydroxy-1-Anthryl) Ester; (8-Acetyloxy-9-Hydroxy-Anthracen-1-Yl) Ethanoate |
| Molecular Structure |  |
| Molecular Formula | C18H14O5 |
| Molecular Weight | 310.31 |
| CAS Registry Number | 51794-04-8 |
| SMILES | C3=CC=C2C=C1C=CC=C(C1=C(C2=C3OC(C)=O)O)OC(C)=O |
| InChI | 1S/C18H14O5/c1-10(19)22-14-7-3-5-12-9-13-6-4-8-15(23-11(2)20)17(13)18(21)16(12)14/h3-9,21H,1-2H3 |
| InChIKey | VBRLBTHTFWJTRA-UHFFFAOYSA-N |
| Density | 1.341g/cm3 (Cal.) |
|---|---|
| Boiling point | 532.196°C at 760 mmHg (Cal.) |
| Flash point | 197.839°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dithranol 1,8-Diacetate |