Online Database of Chemicals from Around the World
|
CAS#: 5186-68-5 Product: 4,6-Diisopropyl-1,3-Dimethylbenzene No suppilers available for the product. |
| Name | 4,6-Diisopropyl-1,3-Dimethylbenzene |
|---|---|
| Synonyms | 1,5-Diisopropyl-2,4-Dimethyl-Benzene; 1,5-Diisopropyl-2,4-Dimethylbenzene; 1,5-Dimethyl-2,4-Bis(1-Methylethyl)Benzene |
| Molecular Structure |  |
| Molecular Formula | C14H22 |
| Molecular Weight | 190.33 |
| CAS Registry Number | 5186-68-5 |
| SMILES | C1=C(C(C)C)C(=CC(=C1C(C)C)C)C |
| InChI | 1S/C14H22/c1-9(2)13-8-14(10(3)4)12(6)7-11(13)5/h7-10H,1-6H3 |
| InChIKey | PUPZFBLFGPJICA-UHFFFAOYSA-N |
| Density | 0.857g/cm3 (Cal.) |
|---|---|
| Boiling point | 245.366°C at 760 mmHg (Cal.) |
| Flash point | 96.886°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 4,6-Diisopropyl-1,3-Dimethylbenzene |