Online Database of Chemicals from Around the World
|
CAS#: 52112-67-1 Product: 5,7-Dibromo-2-Benzoxazolamine No suppilers available for the product. |
| Name | 5,7-Dibromo-2-Benzoxazolamine |
|---|---|
| Synonyms | (5,7-Dibromo-1,3-Benzoxazol-2-Yl)Amine; 2-Amino-5,7-Dibromobenzoxazole; 2-Benzoxazolamine, 5,7-Dibromo- (9Ci) |
| Molecular Structure |  |
| Molecular Formula | C7H4Br2N2O |
| Molecular Weight | 291.93 |
| CAS Registry Number | 52112-67-1 |
| SMILES | C1=C(C=C(C2=C1N=C(O2)N)Br)Br |
| InChI | 1S/C7H4Br2N2O/c8-3-1-4(9)6-5(2-3)11-7(10)12-6/h1-2H,(H2,10,11) |
| InChIKey | FXYIDUGIODSYAI-UHFFFAOYSA-N |
| Density | 2.175g/cm3 (Cal.) |
|---|---|
| Boiling point | 390.529°C at 760 mmHg (Cal.) |
| Flash point | 189.986°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5,7-Dibromo-2-Benzoxazolamine |