Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 2,2'-Dibromobibenzyl |
|---|---|
| Synonyms | Benzene, 1,1'-(1,2-Ethanediyl)Bis[2-Bromo-; Bibenzyl, 2,2'-Dibromo- |
| Molecular Structure |  |
| Molecular Formula | C14H12Br2 |
| Molecular Weight | 340.06 |
| CAS Registry Number | 59485-34-6 |
| EINECS | 261-783-4 |
| SMILES | C1=CC=CC(=C1CCC2=C(C=CC=C2)Br)Br |
| InChI | 1S/C14H12Br2/c15-13-7-3-1-5-11(13)9-10-12-6-2-4-8-14(12)16/h1-8H,9-10H2 |
| InChIKey | CVGGCYQDKJYOCA-UHFFFAOYSA-N |
| Density | 1.579g/cm3 (Cal.) |
|---|---|
| Boiling point | 358.974°C at 760 mmHg (Cal.) |
| Flash point | 199.361°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2'-Dibromobibenzyl |