Online Database of Chemicals from Around the World
|
CAS#: 52612-52-9 Product: (1S-cis)-1-(2,2,6-Trimethylcyclohexyl)Ethanone No suppilers available for the product. |
| Name | (1S-cis)-1-(2,2,6-Trimethylcyclohexyl)Ethanone |
|---|---|
| Synonyms | (1S-Cis)-1-(2,2,6-Trimethylcyclohexyl)Ethanone |
| Molecular Structure |  |
| Molecular Formula | C11H20O |
| Molecular Weight | 168.28 |
| CAS Registry Number | 52612-52-9 |
| EINECS | 258-046-4 |
| SMILES | [C@H]1(C(CCC[C@@H]1C)(C)C)C(=O)C |
| InChI | 1S/C11H20O/c1-8-6-5-7-11(3,4)10(8)9(2)12/h8,10H,5-7H2,1-4H3/t8-,10+/m0/s1 |
| InChIKey | LGEFCQRTSXYJAD-WCBMZHEXSA-N |
| Density | 0.858g/cm3 (Cal.) |
|---|---|
| Boiling point | 216.591°C at 760 mmHg (Cal.) |
| Flash point | 93.425°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (1S-cis)-1-(2,2,6-Trimethylcyclohexyl)Ethanone |