Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | (1R,5R)-3,3,5-Trimethylcyclohexyl butyrate |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C13H24O2 |
| Molecular Weight | 212.33 |
| CAS Registry Number | 828912-41-0 |
| SMILES | CCCC(=O)O[C@@H]1C[C@@H](CC(C1)(C)C)C |
| InChI | 1S/C13H24O2/c1-5-6-12(14)15-11-7-10(2)8-13(3,4)9-11/h10-11H,5-9H2,1-4H3/t10-,11+/m0/s1 |
| InChIKey | UIFRJGOCMUXTRV-WDEREUQCSA-N |
| Density | 0.9±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 244.8±8.0°C at 760 mmHg (Cal.) |
| Flash point | 105.5±6.0°C (Cal.) |
| Refractive index | 1.453 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (1R,5R)-3,3,5-Trimethylcyclohexyl butyrate |