Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | N-Phenyl-2-Furansulfonamide |
|---|---|
| Synonyms | 2-Furansulfonamide,N-phenyl-; N-phenylfuran-2-sulfonamide |
| Molecular Structure |  |
| Molecular Formula | C10H9NO3S |
| Molecular Weight | 223.25 |
| CAS Registry Number | 52665-43-7 |
| SMILES | c1ccc(cc1)NS(=O)(=O)c2ccco2 |
| InChI | 1S/C10H9NO3S/c12-15(13,10-7-4-8-14-10)11-9-5-2-1-3-6-9/h1-8,11H |
| InChIKey | LDBKVCWPPRRRDM-UHFFFAOYSA-N |
| Density | 1.384g/cm3 (Cal.) |
|---|---|
| Boiling point | 362.033°C at 760 mmHg (Cal.) |
| Flash point | 172.752°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Phenyl-2-Furansulfonamide |