Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 2-Phenylfuro[2,3-b]quinoxalin-3-ol |
|---|---|
| Molecular Structure | ![CAS#: 901114-10-1， 2-Phenylfuro[2,3-b]quinoxalin-3-ol](/moreStructures/901114-10-1.gif) |
| Molecular Formula | C16H10N2O2 |
| Molecular Weight | 262.26 |
| CAS Registry Number | 901114-10-1 |
| SMILES | c1ccc(cc1)c2c(c3c(o2)nc4ccccc4n3)O |
| InChI | 1S/C16H10N2O2/c19-14-13-16(18-12-9-5-4-8-11(12)17-13)20-15(14)10-6-2-1-3-7-10/h1-9,19H |
| InChIKey | YJGVLNYJIJFSPM-UHFFFAOYSA-N |
| Density | 1.376g/cm3 (Cal.) |
|---|---|
| Boiling point | 475.566°C at 760 mmHg (Cal.) |
| Flash point | 241.414°C (Cal.) |
| Refractive index | 1.74 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Phenylfuro[2,3-b]quinoxalin-3-ol |