Online Database of Chemicals from Around the World
|
CAS#: 52671-42-8 Product: 4-Nitrosodiphenyl Ether No suppilers available for the product. |
| Name | 4-Nitrosodiphenyl Ether |
|---|---|
| Synonyms | 1-Nitroso-4-Phenoxybenzene; 4-Nitrosobiphenyl Ether; 4-Nitrosodiphenyl Ether |
| Molecular Structure |  |
| Molecular Formula | C12H9NO2 |
| Molecular Weight | 199.21 |
| CAS Registry Number | 52671-42-8 |
| SMILES | C1=C(C=CC(=C1)OC2=CC=CC=C2)N=O |
| InChI | 1S/C12H9NO2/c14-13-10-6-8-12(9-7-10)15-11-4-2-1-3-5-11/h1-9H |
| InChIKey | AFZZWGLJNSCSAH-UHFFFAOYSA-N |
| Density | 1.124g/cm3 (Cal.) |
|---|---|
| Boiling point | 313.071°C at 760 mmHg (Cal.) |
| Flash point | 146.129°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Nitrosodiphenyl Ether |