Online Database of Chemicals from Around the World
|
CAS#: 28464-26-8 Product: N-Nitroso-(2,2-Dinitropropyl)Amine No suppilers available for the product. |
| Name | N-Nitroso-(2,2-Dinitropropyl)Amine |
|---|---|
| Synonyms | N-Nitrosobis(2,2-Dinitropropyl)Amine; N-Nitroso-(2,2-Dinitropropyl)Amine; N-Nitroso-Bis-(2,2-Dinitropropyl)Amine |
| Molecular Structure |  |
| Molecular Formula | C6H10N6O9 |
| Molecular Weight | 310.18 |
| CAS Registry Number | 28464-26-8 |
| SMILES | C(N(N=O)CC([N+]([O-])=O)([N+]([O-])=O)C)C([N+]([O-])=O)([N+]([O-])=O)C |
| InChI | 1S/C6H10N6O9/c1-5(9(14)15,10(16)17)3-8(7-13)4-6(2,11(18)19)12(20)21/h3-4H2,1-2H3 |
| InChIKey | PQLZMPIPNSKOKH-UHFFFAOYSA-N |
| Density | 1.798g/cm3 (Cal.) |
|---|---|
| Boiling point | 504.056°C at 760 mmHg (Cal.) |
| Flash point | 258.644°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Nitroso-(2,2-Dinitropropyl)Amine |