| Specs Ltd. | Netherlands | Inquire | ||
|---|---|---|---|---|
![]() |
+31 (15) 251-8111 | |||
![]() |
info@specs.net | |||
| Chemical manufacturer since 1987 | ||||
| Name | 2-Acetyl-5-Nitrofuran |
|---|---|
| Synonyms | 1-(5-Nitro-2-Furyl)Ethanone; 2-Acetyl-5-Nitrofuran; 5-Nitro-2-Furyl Methyl Ketone |
| Molecular Structure | ![]() |
| Molecular Formula | C6H5NO4 |
| Molecular Weight | 155.11 |
| CAS Registry Number | 5275-69-4 |
| SMILES | C1=C(OC(=C1)C(=O)C)[N+]([O-])=O |
| InChI | 1S/C6H5NO4/c1-4(8)5-2-3-6(11-5)7(9)10/h2-3H,1H3 |
| InChIKey | ORQQKSZUXNAWAX-UHFFFAOYSA-N |
| Density | 1.342g/cm3 (Cal.) |
|---|---|
| Boiling point | 225.52°C at 760 mmHg (Cal.) |
| Flash point | 90.192°C (Cal.) |
| (1) | Alessandro Baliani, Valerie Peal, Ludovic Gros, Reto Brun, Marcel Kaiser, Michael P. Barrett and Ian H. Gilbert. Novel functionalized melamine-based nitroheterocycles: synthesis and activity against trypanosomatid parasites, Org. Biomol. Chem., 2009, 7, 1154. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2-Acetyl-5-Nitrofuran |