| Carbosynth China Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (512) 6260-5585 | |||
![]() |
sales@carbosynth.com | |||
![]() |
QQ Chat | |||
| Chemical manufacturer since 2006 Chemical distributor since 2006 | ||||
| chemBlink standard supplier since 2016 | ||||
| Classification | Biochemical >> Amino acids and their derivatives >> Cysteine derivative |
|---|---|
| Name | N-Acetyl-S-(4-Nitrophenyl)-L-Cysteine |
| Synonyms | (2R)-2-Acetamido-3-(4-Nitrophenyl)Sulfanyl-Propanoic Acid; (2R)-2-Acetamido-3-[(4-Nitrophenyl)Thio]Propanoic Acid; (2R)-2-Acetamido-3-[(4-Nitrophenyl)Thio]Propionic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C11H12N2O5S |
| Molecular Weight | 284.29 |
| CAS Registry Number | 91088-55-0 |
| SMILES | [C@H](NC(=O)C)(CSC1=CC=C([N+]([O-])=O)C=C1)C(=O)O |
| InChI | 1S/C11H12N2O5S/c1-7(14)12-10(11(15)16)6-19-9-4-2-8(3-5-9)13(17)18/h2-5,10H,6H2,1H3,(H,12,14)(H,15,16)/t10-/m0/s1 |
| InChIKey | LOBKSYPZBSVLLE-JTQLQIEISA-N |
| Density | 1.436g/cm3 (Cal.) |
|---|---|
| Melting point | 158°C (Expl.) |
| Boiling point | 582.555°C at 760 mmHg (Cal.) |
| Flash point | 306.119°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for N-Acetyl-S-(4-Nitrophenyl)-L-Cysteine |