Online Database of Chemicals from Around the World
| ChemDiv, Inc. | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (858) 794-4860 | |||
 |
chemdiv@chemdiv.com | |||
| Chemical manufacturer | ||||
| Name | 1,2-Bis(3,4,5-Trimethoxyphenyl)-1,2-Ethanedione |
|---|---|
| Synonyms | 1,2-BIS(3,4,5-TRIMETHOXYPHENYL)ETHANE-1,2-DIONE; EU-0026986; NSC116292 |
| Molecular Structure |  |
| Molecular Formula | C20H22O8 |
| Molecular Weight | 390.38 |
| CAS Registry Number | 52886-83-6 |
| SMILES | O=C(c1cc(OC)c(OC)c(OC)c1)C(=O)c2cc(OC)c(OC)c(OC)c2 |
| InChI | 1S/C20H22O8/c1-23-13-7-11(8-14(24-2)19(13)27-5)17(21)18(22)12-9-15(25-3)20(28-6)16(10-12)26-4/h7-10H,1-6H3 |
| InChIKey | OIFKAYYDTOHLSS-UHFFFAOYSA-N |
| Density | 1.203g/cm3 (Cal.) |
|---|---|
| Boiling point | 563.953°C at 760 mmHg (Cal.) |
| Flash point | 246.249°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2-Bis(3,4,5-Trimethoxyphenyl)-1,2-Ethanedione |