Online Database of Chemicals from Around the World
| Name | Bis(Trimethoxysilylmethyl) Sulfide |
|---|---|
| Synonyms | Trimethoxy-[(Trimethoxysilylmethylthio)Methyl]Silane; Brn 2258801; Bis(Trimethoxysilylmethyl)Sulfide |
| Molecular Structure |  |
| Molecular Formula | C8H22O6SSi2 |
| Molecular Weight | 302.49 |
| CAS Registry Number | 60764-84-3 |
| SMILES | C([Si](OC)(OC)OC)SC[Si](OC)(OC)OC |
| InChI | 1S/C8H22O6SSi2/c1-9-16(10-2,11-3)7-15-8-17(12-4,13-5)14-6/h7-8H2,1-6H3 |
| InChIKey | RWWILRPQZDRQSH-UHFFFAOYSA-N |
| Density | 1.064g/cm3 (Cal.) |
|---|---|
| Boiling point | 228.13°C at 760 mmHg (Cal.) |
| Flash point | 91.77°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Bis(Trimethoxysilylmethyl) Sulfide |
