Online Database of Chemicals from Around the World
|
CAS#: 5301-38-2 Product: (2,2-Dichlorovinyl) Ethyl Methyl Phosphate No suppilers available for the product. |
| Name | (2,2-Dichlorovinyl) Ethyl Methyl Phosphate |
|---|---|
| Synonyms | 2,2-Dichlorovinyl Ethyl Methyl Phosphate; Phosphoric Acid 2,2-Dichlorovinyl Ethyl Methyl Ester; Brn 1709469 |
| Molecular Structure |  |
| Molecular Formula | C5H9Cl2O4P |
| Molecular Weight | 235.00 |
| CAS Registry Number | 5301-38-2 |
| SMILES | C(C)O[P](=O)(OC)OC=C(Cl)Cl |
| InChI | 1S/C5H9Cl2O4P/c1-3-10-12(8,9-2)11-4-5(6)7/h4H,3H2,1-2H3 |
| InChIKey | JEIAAOWEWXSKGZ-UHFFFAOYSA-N |
| Density | 1.378g/cm3 (Cal.) |
|---|---|
| Boiling point | 198.631°C at 760 mmHg (Cal.) |
| Flash point | 42.964°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2,2-Dichlorovinyl) Ethyl Methyl Phosphate |