| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | Dexindoprofen |
|---|---|
| Synonyms | (2S)-2-[4-(1-Oxoisoindolin-2-Yl)Phenyl]Propanoic Acid; (2S)-2-[4-(1-Oxo-2-Isoindolinyl)Phenyl]Propanoic Acid; (2S)-2-[4-(1-Ketoisoindolin-2-Yl)Phenyl]Propionic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C17H15NO3 |
| Molecular Weight | 281.31 |
| CAS Registry Number | 53086-13-8 |
| EINECS | 258-351-2 |
| SMILES | [C@H](C3=CC=C(N1C(C2=C(C1)C=CC=C2)=O)C=C3)(C(O)=O)C |
| InChI | 1S/C17H15NO3/c1-11(17(20)21)12-6-8-14(9-7-12)18-10-13-4-2-3-5-15(13)16(18)19/h2-9,11H,10H2,1H3,(H,20,21)/t11-/m0/s1 |
| InChIKey | RJMIEHBSYVWVIN-NSHDSACASA-N |
| Density | 1.309g/cm3 (Cal.) |
|---|---|
| Boiling point | 511.259°C at 760 mmHg (Cal.) |
| Flash point | 263°C (Cal.) |
| (1) | K. Ravikumar. Non-steroidal anti-inflammatory drugs. III. Structure of indoprofen: 2-[4-(1-oxo-2-isoindolinyl)phenyl]propionic acid, Acta Cryst. (1994). C50, 589-592 |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Dexindoprofen |