Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 2'-Phenylbenzohydrazide |
|---|---|
| Synonyms | Benzoic Acid, Phenyl Hydrazide; N-Benzoyl-N'-Phenylhydrazine; Nsc24944 |
| Molecular Structure |  |
| Molecular Formula | C13H12N2O |
| Molecular Weight | 212.25 |
| CAS Registry Number | 532-96-7 |
| EINECS | 208-550-5 |
| SMILES | C1=C(C=CC=C1)C(=O)NNC2=CC=CC=C2 |
| InChI | 1S/C13H12N2O/c16-13(11-7-3-1-4-8-11)15-14-12-9-5-2-6-10-12/h1-10,14H,(H,15,16) |
| InChIKey | CKLPECFHCLIYKN-UHFFFAOYSA-N |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2'-Phenylbenzohydrazide |