Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | Neo-Pentyl pivalate |
|---|---|
| Synonyms | 2,2-Dimethylpropanoic Acid 2,2-Dimethylpropyl Ester; 2,2-Dimethylpropionic Acid Neopentyl Ester; 2,2-Dimethylpropanoic Acid, 2,2-Dimethylpropyl Ester |
| Molecular Structure |  |
| Molecular Formula | C10H20O2 |
| Molecular Weight | 172.27 |
| CAS Registry Number | 5340-26-1 |
| SMILES | C(OC(C(C)(C)C)=O)C(C)(C)C |
| InChI | 1S/C10H20O2/c1-9(2,3)7-12-8(11)10(4,5)6/h7H2,1-6H3 |
| InChIKey | KEVRVUAKQLMNFS-UHFFFAOYSA-N |
| Density | 0.874g/cm3 (Cal.) |
|---|---|
| Boiling point | 163.015°C at 760 mmHg (Cal.) |
| Flash point | 53.858°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Neo-Pentyl pivalate |