Online Database of Chemicals from Around the World
| DSL Chemicals (Shanghai) Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 (21) 6352-9955 | |||
 |
info@dsl-chem.com | |||
| Chemical manufacturer since 1997 | ||||
| Name | Di-3,5-Xylylamine |
|---|---|
| Synonyms | N-(3,5-Dimethylphenyl)-3,5-Dimethyl-Aniline; Bis(3,5-Dimethylphenyl)Amine; Di-3,5-Xylylamine |
| Molecular Structure |  |
| Molecular Formula | C16H19N |
| Molecular Weight | 225.33 |
| CAS Registry Number | 5369-25-5 |
| SMILES | C2=C(NC1=CC(=CC(=C1)C)C)C=C(C=C2C)C |
| InChI | 1S/C16H19N/c1-11-5-12(2)8-15(7-11)17-16-9-13(3)6-14(4)10-16/h5-10,17H,1-4H3 |
| InChIKey | VBSGDGQAFLYSEK-UHFFFAOYSA-N |
| Density | 1.022g/cm3 (Cal.) |
|---|---|
| Boiling point | 342.364°C at 760 mmHg (Cal.) |
| Flash point | 165.791°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Di-3,5-Xylylamine |