Online Database of Chemicals from Around the World
|
CAS#: 55990-91-5 Product: Di(2,3-Xylyl) Disulphide No suppilers available for the product. |
| Name | Di(2,3-Xylyl) Disulphide |
|---|---|
| Synonyms | 1-(2,3-Dimethylphenyl)Disulfanyl-2,3-Dimethyl-Benzene; 2,3-Xylyl Disulfide; Di(2,3-Xylyl) Disulphide |
| Molecular Structure |  |
| Molecular Formula | C16H18S2 |
| Molecular Weight | 274.44 |
| CAS Registry Number | 55990-91-5 |
| EINECS | 259-934-4 |
| SMILES | C1=CC=C(C(=C1SSC2=C(C(=CC=C2)C)C)C)C |
| InChI | 1S/C16H18S2/c1-11-7-5-9-15(13(11)3)17-18-16-10-6-8-12(2)14(16)4/h5-10H,1-4H3 |
| InChIKey | XTGZALWKSBATBY-UHFFFAOYSA-N |
| Density | 1.133g/cm3 (Cal.) |
|---|---|
| Boiling point | 372.972°C at 760 mmHg (Cal.) |
| Flash point | 185.448°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Di(2,3-Xylyl) Disulphide |