Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | Glycine-4-Nitroanilide |
|---|---|
| Synonyms | N-(2-Amino-4-Nitro-Phenyl)Acetamide; N-(2-Amino-4-Nitro-Phenyl)Ethanamide; Acetamide, N-(2-Amino-4-Nitrophenyl)- |
| Molecular Structure |  |
| Molecular Formula | C8H9N3O3 |
| Molecular Weight | 195.18 |
| CAS Registry Number | 53987-32-9 |
| EINECS | 258-900-6 |
| SMILES | C1=C(C=C(C(=C1)NC(=O)C)N)[N+]([O-])=O |
| InChI | 1S/C8H9N3O3/c1-5(12)10-8-3-2-6(11(13)14)4-7(8)9/h2-4H,9H2,1H3,(H,10,12) |
| InChIKey | OSPPRBGGVRKEJL-UHFFFAOYSA-N |
| Density | 1.428g/cm3 (Cal.) |
|---|---|
| Boiling point | 475.387°C at 760 mmHg (Cal.) |
| Flash point | 241.305°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Glycine-4-Nitroanilide |