Online Database of Chemicals from Around the World
|
CAS#: 5407-68-1 Product: 5-Nitrofurfuryl Acetate No suppilers available for the product. |
| Name | 5-Nitrofurfuryl Acetate |
|---|---|
| Synonyms | (5-Nitro-2-Furyl)Methyl Acetate; Acetic Acid (5-Nitro-2-Furyl)Methyl Ester; (5-Nitrofuran-2-Yl)Methyl Ethanoate |
| Molecular Structure |  |
| Molecular Formula | C7H7NO5 |
| Molecular Weight | 185.14 |
| CAS Registry Number | 5407-68-1 |
| EINECS | 226-469-3 |
| SMILES | C1=C(OC(=C1)COC(=O)C)[N+]([O-])=O |
| InChI | 1S/C7H7NO5/c1-5(9)12-4-6-2-3-7(13-6)8(10)11/h2-3H,4H2,1H3 |
| InChIKey | PCMLAOQXILPCIL-UHFFFAOYSA-N |
| Density | 1.353g/cm3 (Cal.) |
|---|---|
| Boiling point | 276.42°C at 760 mmHg (Cal.) |
| Flash point | 120.975°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Nitrofurfuryl Acetate |