Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Sigma-Aldrich, Inc. | USA | Inquire | ||
|---|---|---|---|---|
|
+86 (21) 6141-5566 / 800-819-3336 | |||
|
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| Name | 5-Nitrofurfuryl nitrate |
|---|---|
| Synonyms | (5-Nitro-2-Furyl)Methyl Nitrate; Nitric Acid (5-Nitro-2-Furyl)Methyl Ester; 5-Nitrofurfurylnitrate |
| Molecular Structure |  |
| Molecular Formula | C5H4N2O6 |
| Molecular Weight | 188.10 |
| CAS Registry Number | 4077-62-7 |
| SMILES | C1=C(OC(=C1)CO[N+]([O-])=O)[N+]([O-])=O |
| InChI | 1S/C5H4N2O6/c8-6(9)5-2-1-4(13-5)3-12-7(10)11/h1-2H,3H2 |
| InChIKey | IZUDEUAXDJRXOA-UHFFFAOYSA-N |
| Density | 1.574g/cm3 (Cal.) |
|---|---|
| Boiling point | 330.853°C at 760 mmHg (Cal.) |
| Flash point | 153.894°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Nitrofurfuryl nitrate |