Online Database of Chemicals from Around the World
|
CAS#: 5433-24-9 Product: N-3-Pyridinyl-3-Pyridinesulfonamide No suppilers available for the product. |
| Name | N-3-Pyridinyl-3-Pyridinesulfonamide |
|---|---|
| Synonyms | N-(3-Pyridyl)Pyridine-3-Sulfonamide; N-(3-Pyridyl)-3-Pyridinesulfonamide; Nsc5557 |
| Molecular Structure |  |
| Molecular Formula | C10H9N3O2S |
| Molecular Weight | 235.26 |
| CAS Registry Number | 5433-24-9 |
| SMILES | C2=CC=C([S](NC1=CC=CN=C1)(=O)=O)C=N2 |
| InChI | 1S/C10H9N3O2S/c14-16(15,10-4-2-6-12-8-10)13-9-3-1-5-11-7-9/h1-8,13H |
| InChIKey | XFUVOHWFHKNVRC-UHFFFAOYSA-N |
| Density | 1.426g/cm3 (Cal.) |
|---|---|
| Boiling point | 436.709°C at 760 mmHg (Cal.) |
| Flash point | 217.914°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-3-Pyridinyl-3-Pyridinesulfonamide |