|
CAS#: 547-96-6 Product: 3,7,12-Trihydroxycoprostane No suppilers available for the product. |
| Name | 3,7,12-Trihydroxycoprostane |
|---|---|
| Synonyms | (3R,5S,7R,8R,9S,10S,12S,13R,14S,17R)-17-[(1R)-1,5-Dimethylhexyl]-10,13-Dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-Tetradecahydro-1H-Cyclopenta[A]Phenanthrene-3,7,12-Triol; Chebi:16496; 3Alpha,7Alpha,12Alpha-Trihydroxy-5Beta-Cholestane |
| Molecular Structure | ![]() |
| Molecular Formula | C27H48O3 |
| Molecular Weight | 420.67 |
| CAS Registry Number | 547-96-6 |
| SMILES | [C@H]23[C@H]1[C@@]([C@H](CC1)[C@@H](CCCC(C)C)C)([C@@H](O)C[C@@H]2[C@@]4([C@H](C[C@H]3O)C[C@H](O)CC4)C)C |
| InChI | 1S/C27H48O3/c1-16(2)7-6-8-17(3)20-9-10-21-25-22(15-24(30)27(20,21)5)26(4)12-11-19(28)13-18(26)14-23(25)29/h16-25,28-30H,6-15H2,1-5H3/t17-,18+,19-,20-,21+,22+,23-,24+,25+,26+,27-/m1/s1 |
| InChIKey | RIVQQZVHIVNQFH-XJZYBRFWSA-N |
| Density | 1.051g/cm3 (Cal.) |
|---|---|
| Boiling point | 535.466°C at 760 mmHg (Cal.) |
| Flash point | 222.78°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,7,12-Trihydroxycoprostane |