Online Database of Chemicals from Around the World
|
CAS#: 82-83-7 Product: 4,6,7-Trihydroxy-1H-cyclohepta[c]furan-1,3,5-trione No suppilers available for the product. |
| Name | 4,6,7-Trihydroxy-1H-cyclohepta[c]furan-1,3,5-trione |
|---|---|
| Molecular Structure | ![CAS#: 82-83-7， 4,6,7-Trihydroxy-1H-cyclohepta[c]furan-1,3,5-trione](/moreStructures/82-83-7.gif) |
| Molecular Formula | C9H4O7 |
| Molecular Weight | 224.12 |
| CAS Registry Number | 82-83-7 |
| SMILES | O=C2OC(=O)C=1\C2=CC(\O)=C(\O)C(=O)C=1O |
| InChI | 1S/C9H4O7/c10-3-1-2-4(9(15)16-8(2)14)6(12)7(13)5(3)11/h1H,(H3,10,11,12,13) |
| InChIKey | JAJRKOVXTSKCLS-UHFFFAOYSA-N |
| Density | 2.047g/cm3 (Cal.) |
|---|---|
| Boiling point | 404.163°C at 760 mmHg (Cal.) |
| Flash point | 168.516°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,6,7-Trihydroxy-1H-cyclohepta[c]furan-1,3,5-trione |