Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | Propyl Docetrizoate |
|---|---|
| Synonyms | Propyl 3-(Diacetylamino)-2,4,6-Triiodo-Benzoate; 3-(Diacetylamino)-2,4,6-Triiodobenzoic Acid Propyl Ester; 3-(Diacetylamino)-2,4,6-Triiodo-Benzoic Acid Propyl Ester |
| Molecular Structure |  |
| Molecular Formula | C14H14I3NO4 |
| Molecular Weight | 640.98 |
| CAS Registry Number | 5579-08-8 |
| SMILES | C1=C(C(=C(C(=C1I)N(C(C)=O)C(C)=O)I)C(OCCC)=O)I |
| InChI | 1S/C14H14I3NO4/c1-4-5-22-14(21)11-9(15)6-10(16)13(12(11)17)18(7(2)19)8(3)20/h6H,4-5H2,1-3H3 |
| InChIKey | DEVLRUOLAOLLCZ-UHFFFAOYSA-N |
| Density | 2.197g/cm3 (Cal.) |
|---|---|
| Boiling point | 625.87°C at 760 mmHg (Cal.) |
| Flash point | 332.314°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Propyl Docetrizoate |