Online Database of Chemicals from Around the World
|
CAS#: 121013-72-7 Product: 1,1'-Propylene-2,2'-bipyridilium No suppilers available for the product. |
| Name | 1,1'-Propylene-2,2'-bipyridilium |
|---|---|
| Synonyms | Pdq(+); Pdq-Radical; Propylene Diquat |
| Molecular Structure |  |
| Molecular Formula | C13H14N2 |
| Molecular Weight | 198.27 |
| CAS Registry Number | 121013-72-7 |
| SMILES | CC1N3C(=C2N(C1)C=CC=C2)C=CC=C3 |
| InChI | 1S/C13H14N2/c1-11-10-14-8-4-2-6-12(14)13-7-3-5-9-15(11)13/h2-9,11H,10H2,1H3 |
| InChIKey | LZCOLZOYZSYYAG-UHFFFAOYSA-N |
| Density | 1.187g/cm3 (Cal.) |
|---|---|
| Boiling point | 391.542°C at 760 mmHg (Cal.) |
| Flash point | 179.627°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1'-Propylene-2,2'-bipyridilium |