| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Classification | Biochemical >> Amino acids and their derivatives >> Glycine derivatives |
|---|---|
| Name | N-[(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-Heptadecafluorooctyl)Sulfonyl]-N-Propylglycine Potassium Salt |
| Synonyms | Potassium 2-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-Heptadecafluorooctylsulfonyl-Propyl-Amino)Acetate; Potassium 2-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-Heptadecafluorooctylsulfonyl-Propyl-Amino)Ethanoate |
| Molecular Structure | ![]() |
| Molecular Formula | C13H9F17KNO4S |
| Molecular Weight | 637.35 |
| CAS Registry Number | 55910-10-6 |
| EINECS | 259-892-7 |
| SMILES | C(N([S](=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CCC)C([O-])=O.[K+] |
| InChI | 1S/C13H10F17NO4S.K/c1-2-3-31(4-5(32)33)36(34,35)13(29,30)11(24,25)9(20,21)7(16,17)6(14,15)8(18,19)10(22,23)12(26,27)28;/h2-4H2,1H3,(H,32,33);/q;+1/p-1 |
| InChIKey | AIHJEJOJQJDLRE-UHFFFAOYSA-M |
| Boiling point | 359.1°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 171°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-[(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-Heptadecafluorooctyl)Sulfonyl]-N-Propylglycine Potassium Salt |